C15H16N2O — CID 43215614
3-[(2-methoxynaphthalen-1-yl)methylamino]propanenitrile (PubChem CID 43215614) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[(2-methoxynaphthalen-1-yl)methylamino]propanenitrile.
| Compound Name | 3-[(2-methoxynaphthalen-1-yl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 43215614 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-[(2-methoxynaphthalen-1-yl)methylamino]propanenitrile |
| SMILES | COc1ccc2ccccc2c1CNCCC#N |
| InChI | InChI=1S/C15H16N2O/c1-18-15-8-7-12-5-2-3-6-13(12)14(15)11-17-10-4-9-16/h2-3,5-8,17H,4,10-11H2,1H3 |
| InChIKey | FXIKMCKSHLRXEK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|