C20H35IN4O4 — CID 110971584
1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 110971584) has the molecular formula C20H35IN4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110971584 |
| Molecular Formula | C20H35IN4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 1-ethyl-3-(3-morpholin-4-ylpropyl)-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C20H34N4O4.HI/c1-5-21-20(22-9-6-10-24-11-13-28-14-12-24)23-15-16-7-8-17(25-2)19(27-4)18(16)26-3;/h7-8H,5-6,9-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | IEQDRNLSKDGGBD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|