C22H36N4O4 — CID 111348280
1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine (PubChem CID 111348280) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111348280 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C22H36N4O4/c1-5-23-22(24-13-9-15-26-14-8-6-7-10-19(26)27)25-16-17-11-12-18(28-2)21(30-4)20(17)29-3/h11-12H,5-10,13-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | BNCZVIBZSWEGQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|