C12H16Cl2NO2- — CID 53351457
4-[(5-chloro-2-methoxyphenyl)methyl]morpholine chloride (PubChem CID 53351457) has the molecular formula C12H16Cl2NO2- and a molecular weight of 277.17 g/mol. Its IUPAC name is 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine chloride.
| Compound Name | 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine chloride |
|---|---|
| PubChem CID | 53351457 |
| Molecular Formula | C12H16Cl2NO2- |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine chloride |
| SMILES | COc1ccc(Cl)cc1CN1CCOCC1.[Cl-] |
| InChI | InChI=1S/C12H16ClNO2.ClH/c1-15-12-3-2-11(13)8-10(12)9-14-4-6-16-7-5-14;/h2-3,8H,4-7,9H2,1H3;1H/p-1 |
| InChIKey | PXPTZYJQESXHME-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |