C14H21Cl2NO2 — CID 660603
4-[(5-chloro-2-propoxyphenyl)methyl]morpholine;hydron;chloride (PubChem CID 660603) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is 4-[(5-chloro-2-propoxyphenyl)methyl]morpholine;hydron;chloride.
| Compound Name | 4-[(5-chloro-2-propoxyphenyl)methyl]morpholine;hydron;chloride |
|---|---|
| PubChem CID | 660603 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[(5-chloro-2-propoxyphenyl)methyl]morpholine;hydron;chloride |
| SMILES | CCCOc1ccc(Cl)cc1CN1CCOCC1.[Cl-].[H+] |
| InChI | InChI=1S/C14H20ClNO2.ClH/c1-2-7-18-14-4-3-13(15)10-12(14)11-16-5-8-17-9-6-16;/h3-4,10H,2,5-9,11H2,1H3;1H |
| InChIKey | IJRVKFOSOZGHLN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |