C15H25ClN2O2 — CID 177027735
4-[2-(5-chloro-2-ethoxyphenyl)ethyl]morpholine;methanamine (PubChem CID 177027735) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-ethoxyphenyl)ethyl]morpholine;methanamine.
| Compound Name | 4-[2-(5-chloro-2-ethoxyphenyl)ethyl]morpholine;methanamine |
|---|---|
| PubChem CID | 177027735 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-[2-(5-chloro-2-ethoxyphenyl)ethyl]morpholine;methanamine |
| SMILES | CCOc1ccc(Cl)cc1CCN1CCOCC1.CN |
| InChI | InChI=1S/C14H20ClNO2.CH5N/c1-2-18-14-4-3-13(15)11-12(14)5-6-16-7-9-17-10-8-16;1-2/h3-4,11H,2,5-10H2,1H3;2H2,1H3 |
| InChIKey | TYORGUQAMJSWKM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |