4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride

C16H24Cl2NO2- — CID 53313942

IUPAC4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride
SMILESCCCCCOc1ccc(Cl)cc1CN1CCOCC1.[Cl-]
InChIInChI=1S/C16H24ClNO2.ClH/c1-2-3-4-9-20-16-6-5-15(17)12-14(16)13-18-7-10-19-11-8-18;/h5-6,12H,2-4,7-11,13H2,1H3;1H/p-1
InChIKeyIBFLUOVGAKPONA-UHFFFAOYSA-M
MW333.28 g/mol
LogP0.75
Rot. Bonds7

About 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride

4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride (PubChem CID 53313942) has the molecular formula C16H24Cl2NO2- and a molecular weight of 333.28 g/mol. Its IUPAC name is 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride.

Molecular Properties

Compound Name4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride
PubChem CID53313942
Molecular FormulaC16H24Cl2NO2-
Molecular Weight333.28 g/mol
Exact Mass332.12
IUPAC Name4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride
SMILESCCCCCOc1ccc(Cl)cc1CN1CCOCC1.[Cl-]
InChIInChI=1S/C16H24ClNO2.ClH/c1-2-3-4-9-20-16-6-5-15(17)12-14(16)13-18-7-10-19-11-8-18;/h5-6,12H,2-4,7-11,13H2,1H3;1H/p-1
InChIKeyIBFLUOVGAKPONA-UHFFFAOYSA-M
XLogP0.75
TPSA21.70 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.28
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride?
The IUPAC name of 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride (CID 53313942) is 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride.
What is the SMILES notation for 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride?
The canonical SMILES for 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride is CCCCCOc1ccc(Cl)cc1CN1CCOCC1.[Cl-].
What is the InChIKey of 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride?
The InChIKey is IBFLUOVGAKPONA-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H24ClNO2.ClH/c1-2-3-4-9-20-16-6-5-15(17)12-14(16)13-18-7-10-19-11-8-18;/h5-6,12H,2-4,7-11,13H2,1H3;1H/p-1.
What are the key properties of 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride?
4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride has a molecular weight of 333.28 g/mol, XLogP of 0.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride is sourced from PubChem (CID 53313942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).