C16H24Cl2NO2- — CID 53313942
4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride (PubChem CID 53313942) has the molecular formula C16H24Cl2NO2- and a molecular weight of 333.28 g/mol. Its IUPAC name is 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride.
| Compound Name | 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride |
|---|---|
| PubChem CID | 53313942 |
| Molecular Formula | C16H24Cl2NO2- |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[(5-chloro-2-pentoxyphenyl)methyl]morpholine chloride |
| SMILES | CCCCCOc1ccc(Cl)cc1CN1CCOCC1.[Cl-] |
| InChI | InChI=1S/C16H24ClNO2.ClH/c1-2-3-4-9-20-16-6-5-15(17)12-14(16)13-18-7-10-19-11-8-18;/h5-6,12H,2-4,7-11,13H2,1H3;1H/p-1 |
| InChIKey | IBFLUOVGAKPONA-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|