C27H30ClN3O3 — CID 71051988
4-[[2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazol-5-yl]methyl]morpholine (PubChem CID 71051988) has the molecular formula C27H30ClN3O3 and a molecular weight of 480.01 g/mol. Its IUPAC name is 4-[[2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazol-5-yl]methyl]morpholine.
| Compound Name | 4-[[2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazol-5-yl]methyl]morpholine |
|---|---|
| PubChem CID | 71051988 |
| Molecular Formula | C27H30ClN3O3 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[[2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazol-5-yl]methyl]morpholine |
| SMILES | CCCCOc1ccc(Cl)cc1Cc1ccc(-c2nc3ccc(CN4CCOCC4)cc3[nH]2)o1 |
| InChI | InChI=1S/C27H30ClN3O3/c1-2-3-12-33-25-8-5-21(28)16-20(25)17-22-6-9-26(34-22)27-29-23-7-4-19(15-24(23)30-27)18-31-10-13-32-14-11-31/h4-9,15-16H,2-3,10-14,17-18H2,1H3,(H,29,30) |
| InChIKey | UAFZQZBKQNEBCP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|