C23H23ClFNO2 — CID 142224477
4-[[3-chloro-4-[[5-(3-fluoro-4-methylphenyl)furan-2-yl]methyl]phenyl]methyl]morpholine (PubChem CID 142224477) has the molecular formula C23H23ClFNO2 and a molecular weight of 399.89 g/mol. Its IUPAC name is 4-[[3-chloro-4-[[5-(3-fluoro-4-methylphenyl)furan-2-yl]methyl]phenyl]methyl]morpholine.
| Compound Name | 4-[[3-chloro-4-[[5-(3-fluoro-4-methylphenyl)furan-2-yl]methyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 142224477 |
| Molecular Formula | C23H23ClFNO2 |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[[3-chloro-4-[[5-(3-fluoro-4-methylphenyl)furan-2-yl]methyl]phenyl]methyl]morpholine |
| SMILES | Cc1ccc(-c2ccc(Cc3ccc(CN4CCOCC4)cc3Cl)o2)cc1F |
| InChI | InChI=1S/C23H23ClFNO2/c1-16-2-4-19(14-22(16)25)23-7-6-20(28-23)13-18-5-3-17(12-21(18)24)15-26-8-10-27-11-9-26/h2-7,12,14H,8-11,13,15H2,1H3 |
| InChIKey | JGPCDIARGHDPJD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |