C23H32FIN4O — CID 111846464
1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111846464) has the molecular formula C23H32FIN4O and a molecular weight of 526.44 g/mol. Its IUPAC name is 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111846464 |
| Molecular Formula | C23H32FIN4O |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-ethyl-3-[(3-fluoro-4-methylphenyl)methyl]-2-[[3-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCOCC2)c1)NCc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C23H31FN4O.HI/c1-3-25-23(27-16-20-8-7-18(2)22(24)14-20)26-15-19-5-4-6-21(13-19)17-28-9-11-29-12-10-28;/h4-8,13-14H,3,9-12,15-17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | YVNSNYYVULSTDD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|