C21H32N6O2Si — CID 170547516
3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine (PubChem CID 170547516) has the molecular formula C21H32N6O2Si and a molecular weight of 428.61 g/mol. Its IUPAC name is 3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine.
| Compound Name | 3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 170547516 |
| Molecular Formula | C21H32N6O2Si |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(N)c(-c2nc3ccc(CN4CCOCC4)cc3[nH]2)n1 |
| InChI | InChI=1S/C21H32N6O2Si/c1-30(2,3)11-10-29-15-27-14-17(22)20(25-27)21-23-18-5-4-16(12-19(18)24-21)13-26-6-8-28-9-7-26/h4-5,12,14H,6-11,13,15,22H2,1-3H3,(H,23,24) |
| InChIKey | HRZJKMBRLWVGRP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|