C20H24N4OSi — CID 141075677
2-[[3-(1H-benzimidazol-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 141075677) has the molecular formula C20H24N4OSi and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-[[3-(1H-benzimidazol-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(1H-benzimidazol-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141075677 |
| Molecular Formula | C20H24N4OSi |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[[3-(1H-benzimidazol-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2nc3ccccc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C20H24N4OSi/c1-26(2,3)13-12-25-14-24-18-11-7-4-8-15(18)19(23-24)20-21-16-9-5-6-10-17(16)22-20/h4-11H,12-14H2,1-3H3,(H,21,22) |
| InChIKey | SCEVPRCJRVFHDW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|