C20H26N2O2Si — CID 11595556
phenyl-[2-(2-trimethylsilylethoxymethyl)indazol-3-yl]methanol (PubChem CID 11595556) has the molecular formula C20H26N2O2Si and a molecular weight of 354.53 g/mol. Its IUPAC name is phenyl-[2-(2-trimethylsilylethoxymethyl)indazol-3-yl]methanol.
| Compound Name | phenyl-[2-(2-trimethylsilylethoxymethyl)indazol-3-yl]methanol |
|---|---|
| PubChem CID | 11595556 |
| Molecular Formula | C20H26N2O2Si |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | phenyl-[2-(2-trimethylsilylethoxymethyl)indazol-3-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1nc2ccccc2c1C(O)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O2Si/c1-25(2,3)14-13-24-15-22-19(17-11-7-8-12-18(17)21-22)20(23)16-9-5-4-6-10-16/h4-12,20,23H,13-15H2,1-3H3 |
| InChIKey | DULLXFHCSLWQQO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|