C19H25N3OSi — CID 167445677
trimethyl-[2-[[4-(2-methylquinolin-4-yl)pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 167445677) has the molecular formula C19H25N3OSi and a molecular weight of 339.52 g/mol. Its IUPAC name is trimethyl-[2-[[4-(2-methylquinolin-4-yl)pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-(2-methylquinolin-4-yl)pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 167445677 |
| Molecular Formula | C19H25N3OSi |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | trimethyl-[2-[[4-(2-methylquinolin-4-yl)pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1cc(-c2cnn(COCC[Si](C)(C)C)c2)c2ccccc2n1 |
| InChI | InChI=1S/C19H25N3OSi/c1-15-11-18(17-7-5-6-8-19(17)21-15)16-12-20-22(13-16)14-23-9-10-24(2,3)4/h5-8,11-13H,9-10,14H2,1-4H3 |
| InChIKey | SSMPSDAUKOUVSR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|