C19H26BrN3O2Si — CID 145066841
2-[5-bromo-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indol-1-yl]ethanol (PubChem CID 145066841) has the molecular formula C19H26BrN3O2Si and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[5-bromo-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indol-1-yl]ethanol.
| Compound Name | 2-[5-bromo-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indol-1-yl]ethanol |
|---|---|
| PubChem CID | 145066841 |
| Molecular Formula | C19H26BrN3O2Si |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[5-bromo-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indol-1-yl]ethanol |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cn(CCO)c3ccc(Br)cc23)cn1 |
| InChI | InChI=1S/C19H26BrN3O2Si/c1-26(2,3)9-8-25-14-23-12-15(11-21-23)18-13-22(6-7-24)19-5-4-16(20)10-17(18)19/h4-5,10-13,24H,6-9,14H2,1-3H3 |
| InChIKey | BNRBIGPISITJQF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|