C24H34N4O3Si — CID 123425682
4-[1-(2-methoxyethyl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol (PubChem CID 123425682) has the molecular formula C24H34N4O3Si and a molecular weight of 454.65 g/mol. Its IUPAC name is 4-[1-(2-methoxyethyl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[1-(2-methoxyethyl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 123425682 |
| Molecular Formula | C24H34N4O3Si |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 4-[1-(2-methoxyethyl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]-2-methylbut-3-yn-2-ol |
| SMILES | COCCn1cc(-c2cnn(COCC[Si](C)(C)C)c2)c2cc(C#CC(C)(C)O)ncc21 |
| InChI | InChI=1S/C24H34N4O3Si/c1-24(2,29)8-7-20-13-21-22(17-27(9-10-30-3)23(21)15-25-20)19-14-26-28(16-19)18-31-11-12-32(4,5)6/h13-17,29H,9-12,18H2,1-6H3 |
| InChIKey | AFNCQEVSSHSGOS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|