C24H32N4O2Si — CID 123537843
1-[2-[1-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]ethynyl]cyclopentan-1-ol (PubChem CID 123537843) has the molecular formula C24H32N4O2Si and a molecular weight of 436.63 g/mol. Its IUPAC name is 1-[2-[1-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[1-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 123537843 |
| Molecular Formula | C24H32N4O2Si |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[2-[1-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrrolo[2,3-c]pyridin-5-yl]ethynyl]cyclopentan-1-ol |
| SMILES | Cn1cc(-c2cnn(COCC[Si](C)(C)C)c2)c2cc(C#CC3(O)CCCC3)ncc21 |
| InChI | InChI=1S/C24H32N4O2Si/c1-27-17-22(19-14-26-28(16-19)18-30-11-12-31(2,3)4)21-13-20(25-15-23(21)27)7-10-24(29)8-5-6-9-24/h13-17,29H,5-6,8-9,11-12,18H2,1-4H3 |
| InChIKey | KPLZYJFDCDZRJM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|