C17H20F3N3OSi — CID 172989981
3-(trifluoromethyl)-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]benzonitrile (PubChem CID 172989981) has the molecular formula C17H20F3N3OSi and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-(trifluoromethyl)-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]benzonitrile.
| Compound Name | 3-(trifluoromethyl)-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 172989981 |
| Molecular Formula | C17H20F3N3OSi |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-(trifluoromethyl)-5-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]benzonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cc(C#N)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C17H20F3N3OSi/c1-25(2,3)5-4-24-12-23-11-15(10-22-23)14-6-13(9-21)7-16(8-14)17(18,19)20/h6-8,10-11H,4-5,12H2,1-3H3 |
| InChIKey | NXONPVYROVSNTM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|