C16H21ClF2N2O2Si — CID 140810700
2-[[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140810700) has the molecular formula C16H21ClF2N2O2Si and a molecular weight of 374.89 g/mol. Its IUPAC name is 2-[[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140810700 |
| Molecular Formula | C16H21ClF2N2O2Si |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc(Cl)c(OC(F)F)c2)cn1 |
| InChI | InChI=1S/C16H21ClF2N2O2Si/c1-24(2,3)7-6-22-11-21-10-13(9-20-21)12-4-5-14(17)15(8-12)23-16(18)19/h4-5,8-10,16H,6-7,11H2,1-3H3 |
| InChIKey | KSYPPNYGNKYJPB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|