C15H20ClN5OSi — CID 174064420
2-[[4-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 174064420) has the molecular formula C15H20ClN5OSi and a molecular weight of 349.90 g/mol. Its IUPAC name is 2-[[4-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174064420 |
| Molecular Formula | C15H20ClN5OSi |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[[4-(6-chloropyrazolo[1,5-a]pyrazin-4-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nc(Cl)cn3nccc23)cn1 |
| InChI | InChI=1S/C15H20ClN5OSi/c1-23(2,3)7-6-22-11-20-9-12(8-18-20)15-13-4-5-17-21(13)10-14(16)19-15/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | CEXLLODENSNGCE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|