C14H19Cl2N3OSi — CID 87234798
2-[[3-(2,6-dichloro-4-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 87234798) has the molecular formula C14H19Cl2N3OSi and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[[3-(2,6-dichloro-4-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2,6-dichloro-4-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 87234798 |
| Molecular Formula | C14H19Cl2N3OSi |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[[3-(2,6-dichloro-4-pyridinyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc(-c2cc(Cl)nc(Cl)c2)n1 |
| InChI | InChI=1S/C14H19Cl2N3OSi/c1-21(2,3)7-6-20-10-19-5-4-12(18-19)11-8-13(15)17-14(16)9-11/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | RTNUYBRBRVLESY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|