C16H23N3O3Si — CID 164836120
phenyl N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]carbamate (PubChem CID 164836120) has the molecular formula C16H23N3O3Si and a molecular weight of 333.46 g/mol. Its IUPAC name is phenyl N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]carbamate.
| Compound Name | phenyl N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 164836120 |
| Molecular Formula | C16H23N3O3Si |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | phenyl N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]carbamate |
| SMILES | C[Si](C)(C)CCOCn1ccc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C16H23N3O3Si/c1-23(2,3)12-11-21-13-19-10-9-15(18-19)17-16(20)22-14-7-5-4-6-8-14/h4-10H,11-13H2,1-3H3,(H,17,18,20) |
| InChIKey | DEXONXQFZNBXRE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|