C14H20N2O3Si — CID 175824202
2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylic acid (PubChem CID 175824202) has the molecular formula C14H20N2O3Si and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylic acid.
| Compound Name | 2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 175824202 |
| Molecular Formula | C14H20N2O3Si |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(2-trimethylsilylethoxymethyl)indazole-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc2cccc(C(=O)O)c2n1 |
| InChI | InChI=1S/C14H20N2O3Si/c1-20(2,3)8-7-19-10-16-9-11-5-4-6-12(14(17)18)13(11)15-16/h4-6,9H,7-8,10H2,1-3H3,(H,17,18) |
| InChIKey | GUHVGTVLEJSYTE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|