C19H24N4O4Si — CID 67125213
2-[(6-methyl-2-pyridinyl)oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 67125213) has the molecular formula C19H24N4O4Si and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-[(6-methyl-2-pyridinyl)oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-[(6-methyl-2-pyridinyl)oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 67125213 |
| Molecular Formula | C19H24N4O4Si |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[(6-methyl-2-pyridinyl)oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | Cc1cccc(Oc2cnc3c(n2)c(C(=O)O)cn3COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C19H24N4O4Si/c1-13-6-5-7-15(21-13)27-16-10-20-18-17(22-16)14(19(24)25)11-23(18)12-26-8-9-28(2,3)4/h5-7,10-11H,8-9,12H2,1-4H3,(H,24,25) |
| InChIKey | IKKSWGVUPTUZFZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|