C14H18F3N3O3Si — CID 89453202
2-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 89453202) has the molecular formula C14H18F3N3O3Si and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 89453202 |
| Molecular Formula | C14H18F3N3O3Si |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C14H18F3N3O3Si/c1-24(2,3)5-4-23-8-20-7-9(13(21)22)11-12(20)18-6-10(19-11)14(15,16)17/h6-7H,4-5,8H2,1-3H3,(H,21,22) |
| InChIKey | RHRPVSUHBISVMT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|