C25H41N5O4Si — CID 160650367
tert-butyl N-[1-[7-butanoyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]azetidin-3-yl]-N-methylcarbamate (PubChem CID 160650367) has the molecular formula C25H41N5O4Si and a molecular weight of 503.72 g/mol. Its IUPAC name is tert-butyl N-[1-[7-butanoyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]azetidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[7-butanoyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]azetidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 160650367 |
| Molecular Formula | C25H41N5O4Si |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | tert-butyl N-[1-[7-butanoyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]azetidin-3-yl]-N-methylcarbamate |
| SMILES | CCCC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(N3CC(N(C)C(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C25H41N5O4Si/c1-9-10-20(31)19-16-30(17-33-11-12-35(6,7)8)23-22(19)27-21(13-26-23)29-14-18(15-29)28(5)24(32)34-25(2,3)4/h13,16,18H,9-12,14-15,17H2,1-8H3 |
| InChIKey | RKIKMXWJQAHUCA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|