C25H43N5O3Si — CID 171424116
tert-butyl N-[3,3-dimethyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 171424116) has the molecular formula C25H43N5O3Si and a molecular weight of 489.74 g/mol. Its IUPAC name is tert-butyl N-[3,3-dimethyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3,3-dimethyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171424116 |
| Molecular Formula | C25H43N5O3Si |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | tert-butyl N-[3,3-dimethyl-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(c2cnc3c(cnn3COCC[Si](C)(C)C)c2)CC1(C)C |
| InChI | InChI=1S/C25H43N5O3Si/c1-24(2,3)33-23(31)28(6)21-10-11-29(17-25(21,4)5)20-14-19-15-27-30(22(19)26-16-20)18-32-12-13-34(7,8)9/h14-16,21H,10-13,17-18H2,1-9H3 |
| InChIKey | UYLUNBBUTOQUHC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|