C18H28N4OSi — CID 171424145
N-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]bicyclo[1.1.1]pentan-1-amine (PubChem CID 171424145) has the molecular formula C18H28N4OSi and a molecular weight of 344.54 g/mol. Its IUPAC name is N-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]bicyclo[1.1.1]pentan-1-amine.
| Compound Name | N-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]bicyclo[1.1.1]pentan-1-amine |
|---|---|
| PubChem CID | 171424145 |
| Molecular Formula | C18H28N4OSi |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]bicyclo[1.1.1]pentan-1-amine |
| SMILES | CNC12CC(c3cnc4c(cnn4COCC[Si](C)(C)C)c3)(C1)C2 |
| InChI | InChI=1S/C18H28N4OSi/c1-19-18-10-17(11-18,12-18)15-7-14-8-21-22(16(14)20-9-15)13-23-5-6-24(2,3)4/h7-9,19H,5-6,10-13H2,1-4H3 |
| InChIKey | WIRKTUJAJZZDOE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|