C13H22N4OSi — CID 171465915
[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]methanamine (PubChem CID 171465915) has the molecular formula C13H22N4OSi and a molecular weight of 278.43 g/mol. Its IUPAC name is [1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]methanamine.
| Compound Name | [1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]methanamine |
|---|---|
| PubChem CID | 171465915 |
| Molecular Formula | C13H22N4OSi |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]methanamine |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(CN)cnc21 |
| InChI | InChI=1S/C13H22N4OSi/c1-19(2,3)5-4-18-10-17-13-12(9-16-17)6-11(7-14)8-15-13/h6,8-9H,4-5,7,10,14H2,1-3H3 |
| InChIKey | NKXXCOJGFVNZGJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|