C11H22N2OSi — CID 156784527
2-[(4,5-dimethylpyrazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 156784527) has the molecular formula C11H22N2OSi and a molecular weight of 226.40 g/mol. Its IUPAC name is 2-[(4,5-dimethylpyrazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4,5-dimethylpyrazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156784527 |
| Molecular Formula | C11H22N2OSi |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-[(4,5-dimethylpyrazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cnn(COCC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C11H22N2OSi/c1-10-8-12-13(11(10)2)9-14-6-7-15(3,4)5/h8H,6-7,9H2,1-5H3 |
| InChIKey | CFDWDAIJCILQRC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|