C11H18N2OSSi — CID 141109595
trimethyl-[2-(thieno[2,3-d]pyrazol-1-ylmethoxy)ethyl]silane (PubChem CID 141109595) has the molecular formula C11H18N2OSSi and a molecular weight of 254.43 g/mol. Its IUPAC name is trimethyl-[2-(thieno[2,3-d]pyrazol-1-ylmethoxy)ethyl]silane.
| Compound Name | trimethyl-[2-(thieno[2,3-d]pyrazol-1-ylmethoxy)ethyl]silane |
|---|---|
| PubChem CID | 141109595 |
| Molecular Formula | C11H18N2OSSi |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | trimethyl-[2-(thieno[2,3-d]pyrazol-1-ylmethoxy)ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2sccc21 |
| InChI | InChI=1S/C11H18N2OSSi/c1-16(2,3)7-5-14-9-13-10-4-6-15-11(10)8-12-13/h4,6,8H,5,7,9H2,1-3H3 |
| InChIKey | XRINZNRCTJAFMV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|