C20H33BN2O4Si — CID 163251863
2-[[4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163251863) has the molecular formula C20H33BN2O4Si and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[[4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163251863 |
| Molecular Formula | C20H33BN2O4Si |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[[4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1c(B2OC(C)(C)C(C)(C)O2)ccc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H33BN2O4Si/c1-19(2)20(3,4)27-21(26-19)16-9-10-17-15(18(16)24-5)13-22-23(17)14-25-11-12-28(6,7)8/h9-10,13H,11-12,14H2,1-8H3 |
| InChIKey | PXOHPXWVAMTREH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|