C19H30BN3O5Si — CID 147395675
trimethyl-[2-[[5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane (PubChem CID 147395675) has the molecular formula C19H30BN3O5Si and a molecular weight of 419.36 g/mol. Its IUPAC name is trimethyl-[2-[[5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 147395675 |
| Molecular Formula | C19H30BN3O5Si |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | trimethyl-[2-[[5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC1(C)OB(c2nn(COCC[Si](C)(C)C)c3ccc([N+](=O)[O-])cc23)OC1(C)C |
| InChI | InChI=1S/C19H30BN3O5Si/c1-18(2)19(3,4)28-20(27-18)17-15-12-14(23(24)25)8-9-16(15)22(21-17)13-26-10-11-29(5,6)7/h8-9,12H,10-11,13H2,1-7H3 |
| InChIKey | DNSXWGOYCYIKFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|