C28H38N8O4Si2 — CID 160667224
2-[(3-isocyano-5-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;3-isocyano-1-(2-trimethylsilylethoxymethyl)indazol-5-amine (PubChem CID 160667224) has the molecular formula C28H38N8O4Si2 and a molecular weight of 606.84 g/mol. Its IUPAC name is 2-[(3-isocyano-5-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;3-isocyano-1-(2-trimethylsilylethoxymethyl)indazol-5-amine.
| Compound Name | 2-[(3-isocyano-5-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;3-isocyano-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
|---|---|
| PubChem CID | 160667224 |
| Molecular Formula | C28H38N8O4Si2 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 2-[(3-isocyano-5-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;3-isocyano-1-(2-trimethylsilylethoxymethyl)indazol-5-amine |
| SMILES | [C-]#[N+]c1nn(COCC[Si](C)(C)C)c2ccc(N)cc12.[C-]#[N+]c1nn(COCC[Si](C)(C)C)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H18N4O3Si.C14H20N4OSi/c1-15-14-12-9-11(18(19)20)5-6-13(12)17(16-14)10-21-7-8-22(2,3)4;1-16-14-12-9-11(15)5-6-13(12)18(17-14)10-19-7-8-20(2,3)4/h5-6,9H,7-8,10H2,2-4H3;5-6,9H,7-8,10,15H2,2-4H3 |
| InChIKey | RMLRUFHLRPMXCO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|