C20H26N2O4Si — CID 11326637
2-[(1-methoxy-3-methyl-6-nitrocarbazol-9-yl)methoxy]ethyl-trimethylsilane (PubChem CID 11326637) has the molecular formula C20H26N2O4Si and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[(1-methoxy-3-methyl-6-nitrocarbazol-9-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(1-methoxy-3-methyl-6-nitrocarbazol-9-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11326637 |
| Molecular Formula | C20H26N2O4Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[(1-methoxy-3-methyl-6-nitrocarbazol-9-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(C)cc2c3cc([N+](=O)[O-])ccc3n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C20H26N2O4Si/c1-14-10-17-16-12-15(22(23)24)6-7-18(16)21(20(17)19(11-14)25-2)13-26-8-9-27(3,4)5/h6-7,10-12H,8-9,13H2,1-5H3 |
| InChIKey | SNLNANQXEQECHP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 66.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|