C10H19N3O4Si — CID 66614142
2-[(3-methoxy-5-nitropyrazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 66614142) has the molecular formula C10H19N3O4Si and a molecular weight of 273.37 g/mol. Its IUPAC name is 2-[(3-methoxy-5-nitropyrazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3-methoxy-5-nitropyrazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66614142 |
| Molecular Formula | C10H19N3O4Si |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(3-methoxy-5-nitropyrazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc([N+](=O)[O-])n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C10H19N3O4Si/c1-16-9-7-10(13(14)15)12(11-9)8-17-5-6-18(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | ANLPQDODTLFYKA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|