C12H22N2O3Si — CID 171830742
methyl 5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate (PubChem CID 171830742) has the molecular formula C12H22N2O3Si and a molecular weight of 270.40 g/mol. Its IUPAC name is methyl 5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 171830742 |
| Molecular Formula | C12H22N2O3Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl 5-methyl-2-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C12H22N2O3Si/c1-10-8-11(12(15)16-2)14(13-10)9-17-6-7-18(3,4)5/h8H,6-7,9H2,1-5H3 |
| InChIKey | TZOAIKGTIKXUHC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|