C18H27N5O3 — CID 111279141
methyl 5-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111279141) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is methyl 5-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111279141 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | methyl 5-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C18H27N5O3/c1-12-9-13(2)23(22-12)8-6-7-20-18(19-4)21-11-15-10-16(14(3)26-15)17(24)25-5/h9-10H,6-8,11H2,1-5H3,(H2,19,20,21) |
| InChIKey | YMYBYELRJLEAMH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|