C19H28N6O2 — CID 111279091
methyl N-[4-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate (PubChem CID 111279091) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is methyl N-[4-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111279091 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl N-[4-[[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1ccc(NC(=O)OC)cc1 |
| InChI | InChI=1S/C19H28N6O2/c1-14-12-15(2)25(24-14)11-5-10-21-18(20-3)22-13-16-6-8-17(9-7-16)23-19(26)27-4/h6-9,12H,5,10-11,13H2,1-4H3,(H,23,26)(H2,20,21,22) |
| InChIKey | ZEQADOBPVRWALH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|