C21H33N5O — CID 111280455
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(propan-2-yloxymethyl)phenyl]methyl]guanidine (PubChem CID 111280455) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(propan-2-yloxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111280455 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(propan-2-yloxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1ccc(COC(C)C)cc1 |
| InChI | InChI=1S/C21H33N5O/c1-16(2)27-15-20-9-7-19(8-10-20)14-24-21(22-5)23-11-6-12-26-18(4)13-17(3)25-26/h7-10,13,16H,6,11-12,14-15H2,1-5H3,(H2,22,23,24) |
| InChIKey | XTUSUDPDMTUZQV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|