C18H31IN4O5 — CID 111886804
methyl 2-methyl-5-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide (PubChem CID 111886804) has the molecular formula C18H31IN4O5 and a molecular weight of 510.37 g/mol. Its IUPAC name is methyl 2-methyl-5-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide.
| Compound Name | methyl 2-methyl-5-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111886804 |
| Molecular Formula | C18H31IN4O5 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | methyl 2-methyl-5-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCc1cc(C(=O)OC)c(C)o1.I |
| InChI | InChI=1S/C18H30N4O5.HI/c1-12-14(15(23)25-6)10-13(26-12)11-22-16(19-5)20-8-7-9-21-17(24)27-18(2,3)4;/h10H,7-9,11H2,1-6H3,(H,21,24)(H2,19,20,22);1H |
| InChIKey | VCXGXEWVHYYVKS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|