C18H23ClIN3O3 — CID 111882796
methyl 5-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111882796) has the molecular formula C18H23ClIN3O3 and a molecular weight of 491.76 g/mol. Its IUPAC name is methyl 5-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111882796 |
| Molecular Formula | C18H23ClIN3O3 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | methyl 5-[[[N-[2-(2-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccc1Cl)NCc1cc(C(=O)OC)c(C)o1.I |
| InChI | InChI=1S/C18H22ClN3O3.HI/c1-12-15(17(23)24-3)10-14(25-12)11-22-18(20-2)21-9-8-13-6-4-5-7-16(13)19;/h4-7,10H,8-9,11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | FOINNXJFGGNQQU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|