C13H22IN3O3 — CID 111124962
methyl 2-methyl-5-[[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]methyl]furan-3-carboxylate;hydroiodide (PubChem CID 111124962) has the molecular formula C13H22IN3O3 and a molecular weight of 395.24 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]methyl]furan-3-carboxylate;hydroiodide.
| Compound Name | methyl 2-methyl-5-[[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]methyl]furan-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111124962 |
| Molecular Formula | C13H22IN3O3 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | methyl 2-methyl-5-[[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]methyl]furan-3-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCc1cc(C(=O)OC)c(C)o1)NC(C)C.I |
| InChI | InChI=1S/C13H21N3O3.HI/c1-8(2)16-13(14-4)15-7-10-6-11(9(3)19-10)12(17)18-5;/h6,8H,7H2,1-5H3,(H2,14,15,16);1H |
| InChIKey | AAIUYIJPMNLTHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|