C17H30N4O4 — CID 111652252
methyl 5-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111652252) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl 5-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111652252 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | methyl 5-[[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C17H30N4O4/c1-13-15(16(22)24-5)11-14(25-13)12-20-17(18-2)19-7-9-21(3)8-6-10-23-4/h11H,6-10,12H2,1-5H3,(H2,18,19,20) |
| InChIKey | LNLCDEWXEGCSEW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|