C16H27N3O3 — CID 111161123
methyl 5-[[(N-hexyl-N'-methylcarbamimidoyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111161123) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl 5-[[(N-hexyl-N'-methylcarbamimidoyl)amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(N-hexyl-N'-methylcarbamimidoyl)amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111161123 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | methyl 5-[[(N-hexyl-N'-methylcarbamimidoyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCCCCCN/C(=N\C)NCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C16H27N3O3/c1-5-6-7-8-9-18-16(17-3)19-11-13-10-14(12(2)22-13)15(20)21-4/h10H,5-9,11H2,1-4H3,(H2,17,18,19) |
| InChIKey | SPUVXBBTOUKNSU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|