C18H31IN4O2 — CID 111358881
tert-butyl N-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111358881) has the molecular formula C18H31IN4O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111358881 |
| Molecular Formula | C18H31IN4O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCc1ccccc1C.I |
| InChI | InChI=1S/C18H30N4O2.HI/c1-14-9-6-7-10-15(14)13-22-16(19-5)20-11-8-12-21-17(23)24-18(2,3)4;/h6-7,9-10H,8,11-13H2,1-5H3,(H,21,23)(H2,19,20,22);1H |
| InChIKey | MBDPGYSPGGCAOK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|