C20H36IN5O3 — CID 111886374
tert-butyl N-[3-[[N-[(2-butoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886374) has the molecular formula C20H36IN5O3 and a molecular weight of 521.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[(2-butoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[(2-butoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886374 |
| Molecular Formula | C20H36IN5O3 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | tert-butyl N-[3-[[N-[(2-butoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCCCOc1ncccc1CN/C(=N/C)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H35N5O3.HI/c1-6-7-14-27-17-16(10-8-11-22-17)15-25-18(21-5)23-12-9-13-24-19(26)28-20(2,3)4;/h8,10-11H,6-7,9,12-15H2,1-5H3,(H,24,26)(H2,21,23,25);1H |
| InChIKey | UDIBHDXUJLMGRF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|