C16H27N5O2 — CID 110971231
tert-butyl N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]carbamate (PubChem CID 110971231) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 110971231 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCc1ccccn1 |
| InChI | InChI=1S/C16H27N5O2/c1-16(2,3)23-15(22)20-11-7-10-19-14(17-4)21-12-13-8-5-6-9-18-13/h5-6,8-9H,7,10-12H2,1-4H3,(H,20,22)(H2,17,19,21) |
| InChIKey | JXRNCJREIRUADR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|