C18H30IN5O2 — CID 110970222
tert-butyl N-cyclopropyl-N-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 110970222) has the molecular formula C18H30IN5O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110970222 |
| Molecular Formula | C18H30IN5O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C(=O)OC(C)(C)C)C1CC1)NCc1ccccn1.I |
| InChI | InChI=1S/C18H29N5O2.HI/c1-18(2,3)25-17(24)23(15-8-9-15)12-11-21-16(19-4)22-13-14-7-5-6-10-20-14;/h5-7,10,15H,8-9,11-13H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | OLUOIHAFGXJMDB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|