C17H28IN5 — CID 110970488
1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110970488) has the molecular formula C17H28IN5 and a molecular weight of 429.35 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110970488 |
| Molecular Formula | C17H28IN5 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(CC1CC1)C1CC1)NCc1ccccn1.I |
| InChI | InChI=1S/C17H27N5.HI/c1-18-17(21-12-15-4-2-3-9-19-15)20-10-11-22(16-7-8-16)13-14-5-6-14;/h2-4,9,14,16H,5-8,10-13H2,1H3,(H2,18,20,21);1H |
| InChIKey | DXVBHIJOIMGRHV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|